ChemNet > CAS > 31270-80-1 4-chlorofuro[3,2-c]pyridine
31270-80-1 4-chlorofuro[3,2-c]pyridine
termék neve |
4-chlorofuro[3,2-c]pyridine |
MF |
C7H4ClNO |
Molekulatömeg |
153.5658 |
InChI |
InChI=1/C7H4ClNO/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H |
CAS-szám |
31270-80-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.377g/cm3 |
Olvadáspont |
40℃ |
Forráspont |
242.806°C at 760 mmHg |
Törésmutató |
1.624 |
Gyulladáspont |
100.646°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|